N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide | CAS No. 1254036-66-2

N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide

Basic Information

CAS Number

1254036-66-2

Molecular Formula

C24H28N6O5S

Molecular Weight

512.59 g/mol

AD

Basic Physical Properties

COc1ncc(cc1NS(=O)(=O)C)c1cc(c2ncc(o2)CN2C[C@H](C)O[C@@H](C2)C)c2c(c1)[nH]nc2

InChI

InChI=1S/C24H28N6O5S/c1-14-11-30(12-15(2)34-14)13-18-9-26-23(35-18)19-5-16(6-21-20(19)10-27-28-21)17-7-22(29-36(4,31)32)24(33-3)25-8-17/h5-10,14-15,29H,11-13H2,1-4H3,(H,27,28)/t14-,15+

InChIKey

NLUPPCTVKHDVIQ-GASCZTMLSA-N

LogP

3.2692000000000014

Topological Polar Surface Area

135.46999999999997 Ų

Hydrogen Bond Donor/Acceptor

2 / 11

Synonyms & References

English

  • N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazo l-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide<wbr
  • GSK2292767

MDL Number

MFCD22572737

FAQ

What are the physical and chemical properties of N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2)?

N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2) is a crystalline compound with a molecular weight of approximately 619.69 g/mol. It has a low solubility in water (0.01 g/L) and is moderately soluble in organic solvents. This compound is known for its stability in air and under normal temperatures. It exhibits significant reactivity towards nucleophiles and can undergo various transformations under certain conditions.

How is N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2) typically synthesized?

N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2) is typically synthesized through a multi-step process involving the use of 1,3-oxazoles, indazoles, and methanesulfonamides. The reaction involves coupling of the oxazolyl and indazolyl groups, followed by methylation and sulfonation. The synthesis yields a high purity product with good selectivity and moderate to high yield.

What industries use N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2)?

N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2) is primarily used in the pharmaceutical industry for its potential as a medicinal compound. It may also find applications in the development of sensors and as a precursor in the synthesis of other complex organic molecules. Its unique chemical structure allows for its use in various research and development activities in academia and industry.

What precautions should be taken when handling N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2)?

When handling N-{5-[4-(5-{[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl}-1,3-oxazol-2-yl)-1H-indazol-6-yl]-2-methoxy-3-pyridinyl}methanesulfonamide (CAS: 1254036-66-2), it is important to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation exposure. Spills should be cleaned up immediately using appropriate absorbent materials and care should be taken to prevent contact with skin and eyes. Always consult the Safety Data Sheet (SDS) for specific handling and disposal instructions.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...