Compound Q&A

How should 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1) be stored?

Answer

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid
5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) should be stored in a cool, dry place away from direct sunlight and heat sources. Keep the container tightly closed to prevent moisture absorption. Store it in a well-ventilated area and ensure that it is away from any ignition sources. Use appropriate storage containers that are compatible with the chemical to prevent any degradation or reaction with the container material.

About

English Name 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid
Molecular Formula C9H6N2O5S
Molecular Weight 254.22 g/mol
SMILES COC1=C(C2=C(C=C1)SC(=N2)C(=O)O)[N+](=O)[O-]
InChIKey KFABCBLZDFFRFD-UHFFFAOYSA-N
Last Updated: 2026-04-03 12:52

Related Q&A

Compound Q&A

What is 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1)?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is an organic compound with a ...

Compound Q&A

What are the main uses of 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1)?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is primarily used in the synth...

Compound Q&A

Is 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1) safe?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is generally considered safe w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...