Compound Q&A

What are the main uses of 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1)?

Answer

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid
5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is primarily used in the synthesis of other compounds, particularly in medicinal chemistry for drug development. It also finds applications in analytical chemistry as a reagent and in the development of new materials and pharmaceuticals.

About

English Name 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid
Molecular Formula C9H6N2O5S
Molecular Weight 254.22 g/mol
SMILES COC1=C(C2=C(C=C1)SC(=N2)C(=O)O)[N+](=O)[O-]
InChIKey KFABCBLZDFFRFD-UHFFFAOYSA-N
Last Updated: 2026-04-03 12:52

Related Q&A

Compound Q&A

What is 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1)?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is an organic compound with a ...

Compound Q&A

Is 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1) safe?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is generally considered safe w...

Compound Q&A

How should 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1) be stored?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...