Compound Q&A

What is 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1)?

Answer

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid
5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is an organic compound with a molecular formula of C12H9N3O4S. It features a thiazole ring fused with a benzene ring and contains a nitro and methoxy group substituents. This compound is known for its stability and can be used in various research and industrial applications due to its unique chemical properties.

About

English Name 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid
Molecular Formula C9H6N2O5S
Molecular Weight 254.22 g/mol
SMILES COC1=C(C2=C(C=C1)SC(=N2)C(=O)O)[N+](=O)[O-]
InChIKey KFABCBLZDFFRFD-UHFFFAOYSA-N
Last Updated: 2026-04-03 12:52

Related Q&A

Compound Q&A

What are the main uses of 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1)?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is primarily used in the synth...

Compound Q&A

Is 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1) safe?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) is generally considered safe w...

Compound Q&A

How should 5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS: 886745-59-1) be stored?

5-Methoxy-4-nitrobenzo[D]thiazole-2-carboxylic acid (CAS 886745-59-1) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...