Compound Q&A

What industries use 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

Answer

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride
2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also used in the research of sensors and semiconductors for its unique electronic properties. Due to its chemical structure, it can be utilized in the development of materials with specific functionalities in these industries.

About

English Name 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride
Molecular Formula C10H15ClFN
Molecular Weight 203.68 g/mol
SMILES CC(C)(CN)C1=CC(=CC=C1)F.Cl
InChIKey FTBGXTIPEHEJNY-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is a white crystalline solid with a molecula...

Compound Q&A

How is 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5) typically synthesized?

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is typically synthesized via the reaction of...

Compound Q&A

What precautions should be taken when handling 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

When handling 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride, it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...