Compound Q&A

What are the physical and chemical properties of 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

Answer

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride
2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is a white crystalline solid with a molecular weight of approximately 223.74 g/mol. It has a pKa of around 10.2 and is soluble in water. It is less soluble in organic solvents like methanol and ethanol. This compound is less reactive than its parent compound, showing limited reactivity in acidic and basic media. It exhibits good solubility in polar aprotic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO).

About

English Name 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride
Molecular Formula C10H15ClFN
Molecular Weight 203.68 g/mol
SMILES CC(C)(CN)C1=CC(=CC=C1)F.Cl
InChIKey FTBGXTIPEHEJNY-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

How is 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5) typically synthesized?

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is typically synthesized via the reaction of...

Compound Q&A

What industries use 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

When handling 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride, it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...