Compound Q&A

How is 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5) typically synthesized?

Answer

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride
2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is typically synthesized via the reaction of 3-fluorophenyl isocyanate with 2-methylpropylamine. The reaction is conducted in a polar aprotic solvent like DMF or DMSO. The yield is generally high, around 85-90%, and the reaction is catalyzed by a basic substances like triethylamine. The selectivity is good, and side products are minimal.

About

English Name 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride
Molecular Formula C10H15ClFN
Molecular Weight 203.68 g/mol
SMILES CC(C)(CN)C1=CC(=CC=C1)F.Cl
InChIKey FTBGXTIPEHEJNY-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is a white crystalline solid with a molecula...

Compound Q&A

What industries use 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride (CAS: 1381944-57-5)?

When handling 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride, it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...