Compound Q&A

What are the physical and chemical properties of Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2)?

Answer

Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate
Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2) is a crystalline compound with a molecular weight of approximately 244.23 g/mol. It has a high solubility in organic solvents such as ethanol and methanol. Chemically, it is relatively stable but can react with strong bases. Its reactivity is typical of amide compounds, making it suitable for various synthetic applications.

About

English Name Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES CCOC(=O)C1=CN=C2C(=C1)C=NN2
InChIKey DWBSMBXTDIFAGZ-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

How is Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2) typically synthesized?

Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2) is synthesized through the conden...

Compound Q&A

What industries use Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2)?

Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2)?

When handling Ethyl 1H-pyrazolo[3,4-B]pyridine-5-carboxylate (CAS: 1256824-48-2), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...