Compound Q&A

What precautions should be taken when handling 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

Answer

4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate
When handling the compound, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and protective clothing. The compound should be stored in a fume hood or a well-ventilated area to minimize inhalation risks. In case of spillage, immediately clean up using appropriate absorbents and dispose of the waste according to safety data sheet (SDS) guidelines. Always refer to the SDS for specific safety instructions.

About

CAS No 84601-02-5
English Name 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate
Molecular Formula C31H44O3
Molecular Weight 464.69 g/mol
SMILES CCCCCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)C3CCC(CC3)CCCCC
InChIKey VEVLKNQODQPWJT-DIVCQZSQSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

The compound has a crystalline form with a molecular weight of approximately 407.6 g/mol. It has a h...

Compound Q&A

How is 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5) typically synthesized?

The compound is typically synthesized through a multistep reaction involving the formation of a phen...

Compound Q&A

What industries use 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

This compound is utilized in the pharmaceutical industry for its potential as a drug precursor, in p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...