Compound Q&A

What industries use 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

Answer

4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate
This compound is utilized in the pharmaceutical industry for its potential as a drug precursor, in polymers for its improved mechanical properties, and in sensors for its chemical sensitivity. It is also explored in the semiconductor industry for its application in photolithography and as a protective coating.

About

CAS No 84601-02-5
English Name 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate
Molecular Formula C31H44O3
Molecular Weight 464.69 g/mol
SMILES CCCCCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)C3CCC(CC3)CCCCC
InChIKey VEVLKNQODQPWJT-DIVCQZSQSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

The compound has a crystalline form with a molecular weight of approximately 407.6 g/mol. It has a h...

Compound Q&A

How is 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5) typically synthesized?

The compound is typically synthesized through a multistep reaction involving the formation of a phen...

Compound Q&A

What precautions should be taken when handling 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

When handling the compound, it is essential to wear appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...