Compound Q&A

How is 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5) typically synthesized?

Answer

4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate
The compound is typically synthesized through a multistep reaction involving the formation of a phenol-derived intermediate, followed by esterification with a cyclohexyl derivative. Commonly used catalysts include sodium hydride and potassium carbonate. The reaction yields a product with high selectivity and good yield, ensuring purity and reliability for industrial applications.

About

CAS No 84601-02-5
English Name 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate
Molecular Formula C31H44O3
Molecular Weight 464.69 g/mol
SMILES CCCCCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)C3CCC(CC3)CCCCC
InChIKey VEVLKNQODQPWJT-DIVCQZSQSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

The compound has a crystalline form with a molecular weight of approximately 407.6 g/mol. It has a h...

Compound Q&A

What industries use 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

This compound is utilized in the pharmaceutical industry for its potential as a drug precursor, in p...

Compound Q&A

What precautions should be taken when handling 4-(Heptyloxy)phenyl 4-(trans-4-pentylcyclohexyl)benzoate (CAS: 84601-02-5)?

When handling the compound, it is essential to wear appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...