Compound Q&A

What industries use Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3)?

Answer

Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate
Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate is primarily used in the pharmaceutical industry for the synthesis of drugs and intermediates. It is also utilized in the polymer industry for the development of functional polymers and in the sensor industry for the production of chemically sensitive materials. Its reactivity and functional groups make it a valuable compound in various applications.

About

English Name Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate
Molecular Formula C12H18N2O3
Molecular Weight 227.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)C(=O)CC#N
InChIKey PCLWTBWRXMOPOV-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3)?

Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate is a white crystalline solid with a molecular ...

Compound Q&A

How is Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3) typically synthesized?

Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate is typically synthesized via the condensation ...

Compound Q&A

What precautions should be taken when handling Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3)?

When handling Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate, it is crucial to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...