Compound Q&A

How is Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3) typically synthesized?

Answer

Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate
Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate is typically synthesized via the condensation of tert-butyl pyrrolidine-1-carboxylate with 2-cyanopropionyl chloride in the presence of a catalyst such as 4-(dimethylamino)pyridine (DMAP) and a phase transfer catalyst like tetrabutylammonium bromide (TBAB). The reaction yields a high purity product with good selectivity and yield, making it a reliable method for industrial production.

About

English Name Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate
Molecular Formula C12H18N2O3
Molecular Weight 227.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)C(=O)CC#N
InChIKey PCLWTBWRXMOPOV-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3)?

Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate is a white crystalline solid with a molecular ...

Compound Q&A

What industries use Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3)?

Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate (CAS: 660406-89-3)?

When handling Tert-butyl 3-(2-cyanoacetyl)pyrrolidine-1-carboxylate, it is crucial to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...