Compound Q&A

What industries use (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

Answer

(E,Z)-3,13-Octadecadienyl acetate
(E,Z)-3,13-Octadecadienyl acetate is used in the fragrance and flavor industry due to its characteristic scent. It is also applied in the chemical industry for the synthesis of other compounds. Additionally, it has potential uses in the pharmaceutical industry as a precursor or intermediate. Its chemical properties make it suitable for applications in polymer science and as a component in sensor technology.

About

CAS No 53120-26-6
English Name (E,Z)-3,13-Octadecadienyl acetate
Molecular Formula C20H36O2
Molecular Weight 308.51 g/mol
SMILES CCCCC=CCCCCCCCCC=CCCOC(=O)C
InChIKey VVJPJXKHBZNADP-ZSTZHTMOSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

(E,Z)-3,13-Octadecadienyl acetate is a liquid at room temperature. It has a molecular weight of appr...

Compound Q&A

How is (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6) typically synthesized?

(E,Z)-3,13-Octadecadienyl acetate is commonly synthesized through the esterification of (E,Z)-3,13-o...

Compound Q&A

What precautions should be taken when handling (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

When handling (E,Z)-3,13-Octadecadienyl acetate, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...