Compound Q&A

How is (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6) typically synthesized?

Answer

(E,Z)-3,13-Octadecadienyl acetate
(E,Z)-3,13-Octadecadienyl acetate is commonly synthesized through the esterification of (E,Z)-3,13-octadecadienol with acetic acid. This process can be catalyzed by a strong acid like sulfuric acid. The yield is generally around 85-90%. The reaction is exothermic and requires careful monitoring to avoid side reactions. Selectivity towards the desired stereoisomer can be achieved by using chiral catalysts.

About

CAS No 53120-26-6
English Name (E,Z)-3,13-Octadecadienyl acetate
Molecular Formula C20H36O2
Molecular Weight 308.51 g/mol
SMILES CCCCC=CCCCCCCCCC=CCCOC(=O)C
InChIKey VVJPJXKHBZNADP-ZSTZHTMOSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

(E,Z)-3,13-Octadecadienyl acetate is a liquid at room temperature. It has a molecular weight of appr...

Compound Q&A

What industries use (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

(E,Z)-3,13-Octadecadienyl acetate is used in the fragrance and flavor industry due to its characteri...

Compound Q&A

What precautions should be taken when handling (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

When handling (E,Z)-3,13-Octadecadienyl acetate, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...