Compound Q&A

What are the physical and chemical properties of (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

Answer

(E,Z)-3,13-Octadecadienyl acetate
(E,Z)-3,13-Octadecadienyl acetate is a liquid at room temperature. It has a molecular weight of approximately 284.39 g/mol. This compound is moderately soluble in common organic solvents like ethanol and acetone but less soluble in water. It is relatively stable under normal conditions but may undergo hydrolysis in the presence of water. It is reactive towards bases and behaves as an ester, which can affect its reactivity in certain chemical reactions.

About

CAS No 53120-26-6
English Name (E,Z)-3,13-Octadecadienyl acetate
Molecular Formula C20H36O2
Molecular Weight 308.51 g/mol
SMILES CCCCC=CCCCCCCCCC=CCCOC(=O)C
InChIKey VVJPJXKHBZNADP-ZSTZHTMOSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6) typically synthesized?

(E,Z)-3,13-Octadecadienyl acetate is commonly synthesized through the esterification of (E,Z)-3,13-o...

Compound Q&A

What industries use (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

(E,Z)-3,13-Octadecadienyl acetate is used in the fragrance and flavor industry due to its characteri...

Compound Q&A

What precautions should be taken when handling (E,Z)-3,13-Octadecadienyl acetate (CAS: 53120-26-6)?

When handling (E,Z)-3,13-Octadecadienyl acetate, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...