Compound Q&A

What industries use (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

Answer

(2-Bromophenyl)(4-chlorophenyl)methanone
(2-Bromophenyl)(4-chlorophenyl)methanone is used in various industries. It finds applications in pharmaceuticals for the synthesis of complex organic molecules, in polymers for functionalization, and in sensors for detecting specific substances. It also plays a role in the development of semiconductors, where its unique properties make it a valuable intermediate.

About

CAS No 99585-64-5
English Name (2-Bromophenyl)(4-chlorophenyl)methanone
Molecular Formula C13H8BrClO
Molecular Weight 295.56 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)Br
InChIKey XKGHDXSJCFWPNB-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

(2-Bromophenyl)(4-chlorophenyl)methanone is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5) typically synthesized?

(2-Bromophenyl)(4-chlorophenyl)methanone is typically synthesized via the coupling of 2-bromophenol ...

Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

When handling (2-Bromophenyl)(4-chlorophenyl)methanone, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...