Compound Q&A

How is (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5) typically synthesized?

Answer

(2-Bromophenyl)(4-chlorophenyl)methanone
(2-Bromophenyl)(4-chlorophenyl)methanone is typically synthesized via the coupling of 2-bromophenol and 4-chlorophenyl methanone using a palladium catalyst under basic conditions. This process involves mild heating and the use of a suitable solvent like toluene. The method yields high purity product with good selectivity and yield, making it suitable for further chemical transformations.

About

CAS No 99585-64-5
English Name (2-Bromophenyl)(4-chlorophenyl)methanone
Molecular Formula C13H8BrClO
Molecular Weight 295.56 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)Br
InChIKey XKGHDXSJCFWPNB-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

(2-Bromophenyl)(4-chlorophenyl)methanone is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

(2-Bromophenyl)(4-chlorophenyl)methanone is used in various industries. It finds applications in pha...

Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

When handling (2-Bromophenyl)(4-chlorophenyl)methanone, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...