Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

Answer

(2-Bromophenyl)(4-chlorophenyl)methanone
(2-Bromophenyl)(4-chlorophenyl)methanone is a crystalline compound with a molecular weight of approximately 297.04 g/mol. It is sparingly soluble in water but soluble in organic solvents like methanol and dichloromethane. This compound is generally stable but can react with strong bases or reducing agents. It is commonly used in organic synthesis due to its reactivity and unique structural features.

About

CAS No 99585-64-5
English Name (2-Bromophenyl)(4-chlorophenyl)methanone
Molecular Formula C13H8BrClO
Molecular Weight 295.56 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)Br
InChIKey XKGHDXSJCFWPNB-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5) typically synthesized?

(2-Bromophenyl)(4-chlorophenyl)methanone is typically synthesized via the coupling of 2-bromophenol ...

Compound Q&A

What industries use (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

(2-Bromophenyl)(4-chlorophenyl)methanone is used in various industries. It finds applications in pha...

Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)(4-chlorophenyl)methanone (CAS: 99585-64-5)?

When handling (2-Bromophenyl)(4-chlorophenyl)methanone, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...