Compound Q&A

How is 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5) typically synthesized?

Answer

8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone
8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone can be synthesized via a multi-step process, starting from 4,4-dimethylquinoline. The key steps involve chlorination and dehydration reactions, often catalyzed by mercury(II) chloride or similar Lewis acids. The overall yield is around 70-80%, with excellent selectivity towards the target product. The reaction conditions require the use of anhydrous solvents and controlled temperatures to ensure product purity.

About

English Name 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone
Molecular Formula C11H12ClNO
Molecular Weight 209.67599999999996 g/mol
SMILES O=C1Nc2c(Cl)cccc2C(C1)(C)C
InChIKey DKDXVAZEBXCVKQ-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5)?

8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone is a solid compound with a crystalline form and ...

Compound Q&A

What industries use 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5)?

8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5)?

When handling 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone, it is essential to wear appropria...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...