Compound Q&A

What are the physical and chemical properties of 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5)?

Answer

8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone
8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone is a solid compound with a crystalline form and a molecular weight of approximately 247.01 g/mol. It has limited water solubility but is soluble in common organic solvents like DMSO and acetonitrile. The compound is relatively stable under normal conditions but can react with strong bases to produce quinoline. It is insoluble in water and has a pKa value of about 7.5.

About

English Name 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone
Molecular Formula C11H12ClNO
Molecular Weight 209.67599999999996 g/mol
SMILES O=C1Nc2c(Cl)cccc2C(C1)(C)C
InChIKey DKDXVAZEBXCVKQ-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5) typically synthesized?

8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone can be synthesized via a multi-step process, sta...

Compound Q&A

What industries use 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5)?

8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone (CAS: 676116-21-5)?

When handling 8-Chloro-4,4-dimethyl-3,4-dihydro-2(1H)-quinolinone, it is essential to wear appropria...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...