Compound Q&A

What industries use 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0)?

Answer

4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid
4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) is primarily used in the pharmaceutical industry for the development of anti-inflammatory and analgesic drugs. It is also used in the formulation of certain polymers and as a precursor in the production of sensors and semiconductors.

About

English Name 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid
Molecular Formula C12H14FNO4S
Molecular Weight 287.31 g/mol
SMILES OC(=O)c1ccc(c(c1)S(=O)(=O)N1CCCCC1)F
InChIKey MOVTXEIZLBYCGT-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0)?

4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) is a crystalline solid with a mole...

Compound Q&A

How is 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) typically synthesized?

4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) is typically synthesized via a mul...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0)?

When handling 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...