Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0)?

Answer

4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid
4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) is a crystalline solid with a molecular weight of approximately 335.34 g/mol. It has a pKa of about 4.5 and is poorly soluble in water but more soluble in organic solvents like methanol and ethanol. The compound is known for its reactivity, particularly in nucleophilic substitution reactions.

About

English Name 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid
Molecular Formula C12H14FNO4S
Molecular Weight 287.31 g/mol
SMILES OC(=O)c1ccc(c(c1)S(=O)(=O)N1CCCCC1)F
InChIKey MOVTXEIZLBYCGT-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) typically synthesized?

4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) is typically synthesized via a mul...

Compound Q&A

What industries use 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0)?

4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0)?

When handling 4-Fluoro-3-(1-piperidinylsulfonyl)benzoic acid (CAS: 311785-51-0), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...