Compound Q&A

What precautions should be taken when handling 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4)?

Answer

8-Chloroquinoline-5-carboxylic acid
When handling 8-Chloroquinoline-5-carboxylic acid, wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Store the compound in a cool, dry place away from direct sunlight and flammable materials. Use a fume hood during handling and disposal. Ensure proper ventilation and follow the Material Safety Data Sheet (MSDS) for all disposal procedures.

About

English Name 8-Chloroquinoline-5-carboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC2=C(C=CC(=C2N=C1)Cl)C(=O)O
InChIKey YCJCLDOHESCJRP-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4)?

8-Chloroquinoline-5-carboxylic acid is a white or off-white crystalline solid with a molecular weigh...

Compound Q&A

How is 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4) typically synthesized?

8-Chloroquinoline-5-carboxylic acid is commonly synthesized via the condensation of 8-chloroquinolin...

Compound Q&A

What industries use 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4)?

8-Chloroquinoline-5-carboxylic acid finds applications in the pharmaceutical industry as a precursor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...