Compound Q&A

What are the physical and chemical properties of 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4)?

Answer

8-Chloroquinoline-5-carboxylic acid
8-Chloroquinoline-5-carboxylic acid is a white or off-white crystalline solid with a molecular weight of approximately 219.02 g/mol. It has a pKa of about 4.0 and is slightly soluble in water. The compound exhibits mild acidity and can participate in esterification and other reactions typical of carboxylic acids. It is moderately reactive towards bases and nucleophiles.

About

English Name 8-Chloroquinoline-5-carboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC2=C(C=CC(=C2N=C1)Cl)C(=O)O
InChIKey YCJCLDOHESCJRP-UHFFFAOYSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4) typically synthesized?

8-Chloroquinoline-5-carboxylic acid is commonly synthesized via the condensation of 8-chloroquinolin...

Compound Q&A

What industries use 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4)?

8-Chloroquinoline-5-carboxylic acid finds applications in the pharmaceutical industry as a precursor...

Compound Q&A

What precautions should be taken when handling 8-Chloroquinoline-5-carboxylic acid (CAS: 121490-68-4)?

When handling 8-Chloroquinoline-5-carboxylic acid, wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...