Compound Q&A

What industries use 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

Answer

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine
3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) is used in pharmaceuticals for the synthesis of various drug intermediates, as well as in the polymer industry for the production of functional materials. It is also utilized in the development of sensors and semiconductors due to its unique electronic properties.

About

CAS No 70310-30-4
English Name 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine
Molecular Formula C14H13NO
Molecular Weight 211.264 g/mol
SMILES C1C(NC2=CC=CC=C2O1)C3=CC=CC=C3
InChIKey BKQRBYFLQYHTCV-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) is a white crystalline solid with a molecu...

Compound Q&A

How is 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) typically synthesized?

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine is typically synthesized through a multistep procedure invol...

Compound Q&A

What precautions should be taken when handling 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

When handling 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4), it is crucial to wear appro...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A