Compound Q&A

What are the physical and chemical properties of 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

Answer

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine
3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) is a white crystalline solid with a molecular weight of approximately 178.2 g/mol. It has a slight solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is reactive towards acidic conditions and can undergo nucleophilic substitution reactions easily.

About

CAS No 70310-30-4
English Name 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine
Molecular Formula C14H13NO
Molecular Weight 211.264 g/mol
SMILES C1C(NC2=CC=CC=C2O1)C3=CC=CC=C3
InChIKey BKQRBYFLQYHTCV-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

How is 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) typically synthesized?

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine is typically synthesized through a multistep procedure invol...

Compound Q&A

What industries use 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) is used in pharmaceuticals for the synthes...

Compound Q&A

What precautions should be taken when handling 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

When handling 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4), it is crucial to wear appro...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A