Compound Q&A

How is 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) typically synthesized?

Answer

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine
3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine is typically synthesized through a multistep procedure involving the diazotization of an aniline followed by benzoxazine formation. The reaction involves using concentrated hydrochloric acid as a catalyst and typically yields a high percentage of the desired product with good selectivity.

About

CAS No 70310-30-4
English Name 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine
Molecular Formula C14H13NO
Molecular Weight 211.264 g/mol
SMILES C1C(NC2=CC=CC=C2O1)C3=CC=CC=C3
InChIKey BKQRBYFLQYHTCV-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) is a white crystalline solid with a molecu...

Compound Q&A

What industries use 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4) is used in pharmaceuticals for the synthes...

Compound Q&A

What precautions should be taken when handling 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4)?

When handling 3-Phenyl-3,4-dihydro-2H-1,4-benzoxazine (CAS: 70310-30-4), it is crucial to wear appro...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A