Compound Q&A

What industries use 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0)?

Answer

2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole
2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole is used in various industries, primarily in pharmaceuticals, where it acts as an antiviral agent. It is also used in the development of new materials for sensors and semiconductors due to its unique electronic and optical properties. In polymer science, it can be used as a stabilizer or for functionalization of polymers.

About

English Name 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole
Molecular Formula C15H14N2S
Molecular Weight 254.36 g/mol
SMILES C(Cc1ccccc1)Sc2nc3ccccc3[nH]2
InChIKey YXSILMYONHYNFY-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0)?

2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole is a white to off-white crystalline solid with a molecu...

Compound Q&A

How is 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0) typically synthesized?

2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole is typically synthesized through a multi-step process i...

Compound Q&A

What precautions should be taken when handling 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0)?

When handling 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...