Compound Q&A

What are the physical and chemical properties of 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0)?

Answer

2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole
2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole is a white to off-white crystalline solid with a molecular weight of approximately 288.34 g/mol. Its solubility in water is low, with a solubility of about 0.1 g/L at 25°C. It is known for its stability under acidic and basic conditions, but it may react with strong oxidizing agents. It is also relatively unreactive towards nucleophiles.

About

English Name 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole
Molecular Formula C15H14N2S
Molecular Weight 254.36 g/mol
SMILES C(Cc1ccccc1)Sc2nc3ccccc3[nH]2
InChIKey YXSILMYONHYNFY-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

How is 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0) typically synthesized?

2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole is typically synthesized through a multi-step process i...

Compound Q&A

What industries use 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0)?

2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole is used in various industries, primarily in pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole (CAS: 167483-31-0)?

When handling 2-[(2-Phenylethyl)sulfanyl]-1H-benzimidazole, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...