Compound Q&A

What industries use Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

Answer

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]-
Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) finds application in various industries, particularly in pharmaceuticals for drug synthesis, in polymer science for functional materials, and in the development of sensors and semiconductors due to its unique chemical properties. Its reactivity and specific functional groups make it a valuable compound in these fields.

About

CAS No 46948-72-5
English Name Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]-
Molecular Formula C13H19NO4S
Molecular Weight 285.37 g/mol
SMILES CN(CCCCCC(=O)O)S(=O)(=O)C1=CC=CC=C1
InChIKey ASJPRZHJNRBKTI-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) is a solid with a crystalline form...

Compound Q&A

How is Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) typically synthesized?

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) can be synthesized through multi-s...

Compound Q&A

What precautions should be taken when handling Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

When handling Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...