Compound Q&A

How is Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) typically synthesized?

Answer

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]-
Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) can be synthesized through multi-step organic chemistry reactions. A typical method involves the use of phenylsulfonyl chloride and methylamine to form the sulfonamide, followed by acylation with hexanoic anhydride to introduce the carboxylic acid group. The reaction conditions, including temperature and catalysts, are carefully controlled to achieve high selectivity and yield.

About

CAS No 46948-72-5
English Name Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]-
Molecular Formula C13H19NO4S
Molecular Weight 285.37 g/mol
SMILES CN(CCCCCC(=O)O)S(=O)(=O)C1=CC=CC=C1
InChIKey ASJPRZHJNRBKTI-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) is a solid with a crystalline form...

Compound Q&A

What industries use Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) finds application in various indus...

Compound Q&A

What precautions should be taken when handling Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

When handling Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...