Compound Q&A

What are the physical and chemical properties of Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

Answer

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]-
Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) is a solid with a crystalline form. It has a molecular weight of approximately 270.26 g/mol and a melting point around 55-57°C. The compound is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is a carboxylic acid with unique reactivity due to the substituted amino group, which can participate in various types of reactions such as esterification and amide formation.

About

CAS No 46948-72-5
English Name Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]-
Molecular Formula C13H19NO4S
Molecular Weight 285.37 g/mol
SMILES CN(CCCCCC(=O)O)S(=O)(=O)C1=CC=CC=C1
InChIKey ASJPRZHJNRBKTI-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

How is Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) typically synthesized?

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) can be synthesized through multi-s...

Compound Q&A

What industries use Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5) finds application in various indus...

Compound Q&A

What precautions should be taken when handling Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5)?

When handling Hexanoic acid, 6-[methyl(phenylsulfonyl)amino]- (CAS: 46948-72-5), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...