Compound Q&A

What industries use HDS 029 (CAS: 881001-19-0)?

Answer

HDS 029
HDS 029 (CAS: 881001-19-0) finds applications in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the semiconductor industry for the fabrication of organic thin-film transistors. Additionally, HDS 029 is explored in the polymer industry for its potential use in developing novel conductive polymers and sensors.

About

English Name HDS 029
Molecular Formula C17H11ClFN5O
Molecular Weight 355.75 g/mol
SMILES CC#CC(=O)Nc1ncc2c(c1)c(ncn2)Nc1ccc(c(c1)Cl)F
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of HDS 029 (CAS: 881001-19-0)?

HDS 029 (CAS: 881001-19-0) is a crystalline compound with a molecular weight of approximately 310.41...

Compound Q&A

How is HDS 029 (CAS: 881001-19-0) typically synthesized?

HDS 029 (CAS: 881001-19-0) is synthesized via a multistep process involving the condensation of an a...

Compound Q&A

What precautions should be taken when handling HDS 029 (CAS: 881001-19-0)?

When handling HDS 029 (CAS: 881001-19-0), it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...