Compound Q&A

What are the physical and chemical properties of HDS 029 (CAS: 881001-19-0)?

Answer

HDS 029
HDS 029 (CAS: 881001-19-0) is a crystalline compound with a molecular weight of approximately 310.41 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetonitrile. Chemically, HDS 029 is highly reactive, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored in a desiccator to prevent moisture absorption.

About

English Name HDS 029
Molecular Formula C17H11ClFN5O
Molecular Weight 355.75 g/mol
SMILES CC#CC(=O)Nc1ncc2c(c1)c(ncn2)Nc1ccc(c(c1)Cl)F
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

How is HDS 029 (CAS: 881001-19-0) typically synthesized?

HDS 029 (CAS: 881001-19-0) is synthesized via a multistep process involving the condensation of an a...

Compound Q&A

What industries use HDS 029 (CAS: 881001-19-0)?

HDS 029 (CAS: 881001-19-0) finds applications in the pharmaceutical industry as an intermediate in t...

Compound Q&A

What precautions should be taken when handling HDS 029 (CAS: 881001-19-0)?

When handling HDS 029 (CAS: 881001-19-0), it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...