Compound Q&A

How is HDS 029 (CAS: 881001-19-0) typically synthesized?

Answer

HDS 029
HDS 029 (CAS: 881001-19-0) is synthesized via a multistep process involving the condensation of an aldehyde and an amine followed by amination. The synthesis typically requires the use of a strong base such as sodium hydride and a catalyst like copper(I) bromide. The reaction is highly selective, yielding HDS 029 with a purity of over 95%, and the yield is approximately 70-75%.

About

English Name HDS 029
Molecular Formula C17H11ClFN5O
Molecular Weight 355.75 g/mol
SMILES CC#CC(=O)Nc1ncc2c(c1)c(ncn2)Nc1ccc(c(c1)Cl)F
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of HDS 029 (CAS: 881001-19-0)?

HDS 029 (CAS: 881001-19-0) is a crystalline compound with a molecular weight of approximately 310.41...

Compound Q&A

What industries use HDS 029 (CAS: 881001-19-0)?

HDS 029 (CAS: 881001-19-0) finds applications in the pharmaceutical industry as an intermediate in t...

Compound Q&A

What precautions should be taken when handling HDS 029 (CAS: 881001-19-0)?

When handling HDS 029 (CAS: 881001-19-0), it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...