Compound Q&A

What industries use Darunavir-d9 (CAS: 1133378-37-6)?

Answer

Darunavir-d9
Darunavir-d9 (CAS: 1133378-37-6) is primarily used in the pharmaceutical industry, particularly in the development of antiretroviral drugs. It is also of interest to researchers in polymer science and sensor technology due to its unique chemical properties.

About

English Name Darunavir-d9
Molecular Formula C27H28D9N3O7S
Molecular Weight 556.72 g/mol
SMILES O=C(O[C@H]1CO[C@@H]2[C@H]1CCO2)N[C@H]([C@@H](CN(C(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])[2H])([2H])[2H])S(=O)(=O)c1ccc(cc1)N)O)Cc1ccccc1
InChIKey CJBJHOAVZSMMDJ-SYUAEXFJSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Darunavir-d9 (CAS: 1133378-37-6)?

Darunavir-d9 (CAS: 1133378-37-6) is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is Darunavir-d9 (CAS: 1133378-37-6) typically synthesized?

Darunavir-d9 (CAS: 1133378-37-6) is synthesized through multi-step reactions involving peptide coupl...

Compound Q&A

What precautions should be taken when handling Darunavir-d9 (CAS: 1133378-37-6)?

When handling Darunavir-d9 (CAS: 1133378-37-6), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...