Compound Q&A

How is Darunavir-d9 (CAS: 1133378-37-6) typically synthesized?

Answer

Darunavir-d9
Darunavir-d9 (CAS: 1133378-37-6) is synthesized through multi-step reactions involving peptide coupling and ring closure. Commonly, solid-phase synthesis techniques are used, which include the use of Fmoc (fluorenylmethoxycarbonyl) protecting groups. The process involves selectivity for specific functional groups and yields around 70-80%.

About

English Name Darunavir-d9
Molecular Formula C27H28D9N3O7S
Molecular Weight 556.72 g/mol
SMILES O=C(O[C@H]1CO[C@@H]2[C@H]1CCO2)N[C@H]([C@@H](CN(C(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])[2H])([2H])[2H])S(=O)(=O)c1ccc(cc1)N)O)Cc1ccccc1
InChIKey CJBJHOAVZSMMDJ-SYUAEXFJSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Darunavir-d9 (CAS: 1133378-37-6)?

Darunavir-d9 (CAS: 1133378-37-6) is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use Darunavir-d9 (CAS: 1133378-37-6)?

Darunavir-d9 (CAS: 1133378-37-6) is primarily used in the pharmaceutical industry, particularly in t...

Compound Q&A

What precautions should be taken when handling Darunavir-d9 (CAS: 1133378-37-6)?

When handling Darunavir-d9 (CAS: 1133378-37-6), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...