Compound Q&A

What are the physical and chemical properties of Darunavir-d9 (CAS: 1133378-37-6)?

Answer

Darunavir-d9
Darunavir-d9 (CAS: 1133378-37-6) is a crystalline compound with a molecular weight of approximately 667.72 g/mol. It has a high solubility in organic solvents such as methanol and ethanol. The compound is relatively stable under normal storage conditions but can react with strong acids or bases. It is typically used in pharmaceutical applications for its antiretroviral properties.

About

English Name Darunavir-d9
Molecular Formula C27H28D9N3O7S
Molecular Weight 556.72 g/mol
SMILES O=C(O[C@H]1CO[C@@H]2[C@H]1CCO2)N[C@H]([C@@H](CN(C(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])[2H])([2H])[2H])S(=O)(=O)c1ccc(cc1)N)O)Cc1ccccc1
InChIKey CJBJHOAVZSMMDJ-SYUAEXFJSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

How is Darunavir-d9 (CAS: 1133378-37-6) typically synthesized?

Darunavir-d9 (CAS: 1133378-37-6) is synthesized through multi-step reactions involving peptide coupl...

Compound Q&A

What industries use Darunavir-d9 (CAS: 1133378-37-6)?

Darunavir-d9 (CAS: 1133378-37-6) is primarily used in the pharmaceutical industry, particularly in t...

Compound Q&A

What precautions should be taken when handling Darunavir-d9 (CAS: 1133378-37-6)?

When handling Darunavir-d9 (CAS: 1133378-37-6), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...