Compound Q&A

What industries use Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0)?

Answer

Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate
Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) is used in the pharmaceutical industry for its potential as a precursor in drug synthesis. It is also used in the polymer industry for the development of new materials with specific properties. Additionally, it can be utilized in the semiconductor industry for its electronic properties.

About

English Name Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate
Molecular Formula C11H7FO4
Molecular Weight 222.17 g/mol
SMILES COC(=O)C1=CC(=O)C2=C(O1)C=CC(=C2)F
InChIKey IWYHARNYXQFPOB-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0)?

Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) is a crystalline compound with a ...

Compound Q&A

How is Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) typically synthesized?

Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) is typically synthesized through ...

Compound Q&A

What precautions should be taken when handling Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0)?

When handling Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0), safety gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...