Compound Q&A

What are the physical and chemical properties of Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0)?

Answer

Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate
Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) is a crystalline compound with a molecular weight of approximately 220.06 g/mol. It is poorly soluble in water but soluble in common organic solvents like methanol and acetone. Chemically, it is stable under normal conditions but can react with strong bases. It shows characteristic chromene UV absorption and has good physical stability.

About

English Name Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate
Molecular Formula C11H7FO4
Molecular Weight 222.17 g/mol
SMILES COC(=O)C1=CC(=O)C2=C(O1)C=CC(=C2)F
InChIKey IWYHARNYXQFPOB-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

How is Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) typically synthesized?

Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) is typically synthesized through ...

Compound Q&A

What industries use Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0)?

Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0)?

When handling Methyl 6-fluoro-4-oxo-4H-chromene-2-carboxylate (CAS: 116543-91-0), safety gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...