Compound Q&A

What are the main uses of 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6)?

Answer

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid
3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drugs. It is also utilized in the research and development of new chemical entities. Additionally, it has potential applications in the synthesis of organic materials and as a reagent in organic synthesis processes.

About

CAS No 46413-67-6
English Name 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid
Molecular Formula C11H10N2O2
Molecular Weight 202.21 g/mol
SMILES CC1=CC=C(C=C1)C2=NNC(=C2)C(=O)O
InChIKey BGTWUOQARPOYER-UHFFFAOYSA-N
Last Updated: 2026-03-31 12:36

Related Q&A

Compound Q&A

What is 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6)?

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid, also known as 3-(4-methylphenyl)-1H-pyrazole-5-car...

Compound Q&A

Is 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6) safe?

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid is generally considered safe for laboratory use whe...

Compound Q&A

How should 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6) be stored?

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...