Compound Q&A

What is 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6)?

Answer

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid
3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid, also known as 3-(4-methylphenyl)-1H-pyrazole-5-carboxylic acid, is a chemical compound with the CAS number 46413-67-6. It belongs to the class of organic compounds known as pyrazole carboxylic acids. This compound has a molecular formula of C11H12N2O2 and is characterized by its aromatic and nitrogen-containing heterocyclic structure.

About

CAS No 46413-67-6
English Name 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid
Molecular Formula C11H10N2O2
Molecular Weight 202.21 g/mol
SMILES CC1=CC=C(C=C1)C2=NNC(=C2)C(=O)O
InChIKey BGTWUOQARPOYER-UHFFFAOYSA-N
Last Updated: 2026-03-31 12:36

Related Q&A

Compound Q&A

What are the main uses of 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6)?

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid is primarily used in the pharmaceutical industry as...

Compound Q&A

Is 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6) safe?

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid is generally considered safe for laboratory use whe...

Compound Q&A

How should 3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS: 46413-67-6) be stored?

3-(4-Methylphenyl)-1H-pyrazole-5-carboxylic acid should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...