Compound Q&A

What industries use 21-hydroxyoligomycin A (CAS: 102042-09-1)?

Answer

21-hydroxyoligomycin A
21-hydroxyoligomycin A (CAS: 102042-09-1) is primarily used in the pharmaceutical industry for developing new antitumor agents and as a research tool. It is also utilized in the biotechnology sector for studying protein-protein interactions and in the field of sensor technology for detecting specific biomolecules.

About

English Name 21-hydroxyoligomycin A
Molecular Formula C45H74O12
Molecular Weight 807.07 g/mol
SMILES CCC1C=CC=CCC(C(C(C(=O)C(C(C(C(=O)C(C(C(C=CC(=O)OC2C(C(CC1O)OC3(C2C)CCC(C(O3)CC(C)O)C)C)C)O)C)C)O)C)(C)O)O)C
InChIKey SCVGLVGTMYJVOI-AAYFJTACSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 21-hydroxyoligomycin A (CAS: 102042-09-1)?

21-hydroxyoligomycin A (CAS: 102042-09-1) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is 21-hydroxyoligomycin A (CAS: 102042-09-1) typically synthesized?

21-hydroxyoligomycin A (CAS: 102042-09-1) is synthesized through a complex multi-step process involv...

Compound Q&A

What precautions should be taken when handling 21-hydroxyoligomycin A (CAS: 102042-09-1)?

When handling 21-hydroxyoligomycin A (CAS: 102042-09-1), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...