Compound Q&A

What are the physical and chemical properties of 21-hydroxyoligomycin A (CAS: 102042-09-1)?

Answer

21-hydroxyoligomycin A
21-hydroxyoligomycin A (CAS: 102042-09-1) is a crystalline compound with a molecular weight of approximately 1314.6 g/mol. It has poor water solubility and is slightly soluble in organic solvents like dimethyl sulfoxide (DMSO). Chemically, it is relatively stable but can react with strong acids or bases under extreme conditions. Its solubility and reactivity make it suitable for specific biochemical assays and drug development.

About

English Name 21-hydroxyoligomycin A
Molecular Formula C45H74O12
Molecular Weight 807.07 g/mol
SMILES CCC1C=CC=CCC(C(C(C(=O)C(C(C(C(=O)C(C(C(C=CC(=O)OC2C(C(CC1O)OC3(C2C)CCC(C(O3)CC(C)O)C)C)C)O)C)C)O)C)(C)O)O)C
InChIKey SCVGLVGTMYJVOI-AAYFJTACSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

How is 21-hydroxyoligomycin A (CAS: 102042-09-1) typically synthesized?

21-hydroxyoligomycin A (CAS: 102042-09-1) is synthesized through a complex multi-step process involv...

Compound Q&A

What industries use 21-hydroxyoligomycin A (CAS: 102042-09-1)?

21-hydroxyoligomycin A (CAS: 102042-09-1) is primarily used in the pharmaceutical industry for devel...

Compound Q&A

What precautions should be taken when handling 21-hydroxyoligomycin A (CAS: 102042-09-1)?

When handling 21-hydroxyoligomycin A (CAS: 102042-09-1), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...