Compound Q&A

How is 21-hydroxyoligomycin A (CAS: 102042-09-1) typically synthesized?

Answer

21-hydroxyoligomycin A
21-hydroxyoligomycin A (CAS: 102042-09-1) is synthesized through a complex multi-step process involving chemical transformations such as condensation, reduction, and oxidation. Common catalysts used include transition metals like palladium and rhodium. The synthetic route aims for high yield and selectivity, with purification through column chromatography and recrystallization steps.

About

English Name 21-hydroxyoligomycin A
Molecular Formula C45H74O12
Molecular Weight 807.07 g/mol
SMILES CCC1C=CC=CCC(C(C(C(=O)C(C(C(C(=O)C(C(C(C=CC(=O)OC2C(C(CC1O)OC3(C2C)CCC(C(O3)CC(C)O)C)C)C)O)C)C)O)C)(C)O)O)C
InChIKey SCVGLVGTMYJVOI-AAYFJTACSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 21-hydroxyoligomycin A (CAS: 102042-09-1)?

21-hydroxyoligomycin A (CAS: 102042-09-1) is a crystalline compound with a molecular weight of appro...

Compound Q&A

What industries use 21-hydroxyoligomycin A (CAS: 102042-09-1)?

21-hydroxyoligomycin A (CAS: 102042-09-1) is primarily used in the pharmaceutical industry for devel...

Compound Q&A

What precautions should be taken when handling 21-hydroxyoligomycin A (CAS: 102042-09-1)?

When handling 21-hydroxyoligomycin A (CAS: 102042-09-1), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...