Compound Q&A

What are the physical and chemical properties of (D-Trp6,D-Leu7)-LHRH Trifluoroacetate (CAS: 321709-37-9)?

Answer

(D-Trp6,D-Leu7)-LHRH Trifluoroacetate
(D-Trp6,D-Leu7)-LHRH Trifluoroacetate is a crystalline compound with a molecular weight of approximately 1049.4 g/mol. It has poor aqueous solubility but good solubility in organic solvents like DMSO. This compound is known for its low reactivity under normal conditions but may react with bases. It is used in pharmaceuticals and research due to its specific biological activity.

About

English Name (D-Trp6,D-Leu7)-LHRH Trifluoroacetate
Molecular Formula C66H83F3N18O15
Molecular Weight 1425.47 g/mol
SMILES CC(C)CC(C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NCC(=O)N)NC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)C(CO)NC(=O)C(CC5=CNC6=CC=CC=C65)NC(=O)C(CC7=CN=CN7)NC(=O)C8CCC(=O)N8.C(=O)(C(F)(F)F)O
InChIKey KHNZXCLOURPVAS-UHFFFAOYSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

How is (D-Trp6,D-Leu7)-LHRH Trifluoroacetate (CAS: 321709-37-9) typically synthesized?

(D-Trp6,D-Leu7)-LHRH Trifluoroacetate is synthesized through solid-phase peptide synthesis (SPPS) fo...

Compound Q&A

What industries use (D-Trp6,D-Leu7)-LHRH Trifluoroacetate (CAS: 321709-37-9)?

(D-Trp6,D-Leu7)-LHRH Trifluoroacetate is primarily used in the pharmaceutical industry for hormone r...

Compound Q&A

What precautions should be taken when handling (D-Trp6,D-Leu7)-LHRH Trifluoroacetate (CAS: 321709-37-9)?

When handling (D-Trp6,D-Leu7)-LHRH Trifluoroacetate, wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...