Compound Q&A

What industries use 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

Answer

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid
2-Methyl-[1,1'-biphenyl]-4-carboxylic acid finds applications in various industries. It is used in the pharmaceutical sector for the synthesis of certain drugs due to its chemical properties. In the polymer industry, it serves as a monomer for the production of special polymers. Additionally, it is utilized in the sensor and semiconductor industries for its unique reactivity and stability.

About

English Name 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid
Molecular Formula C14H12O2
Molecular Weight 212.248 g/mol
SMILES CC1=C(C=CC(=C1)C(=O)O)C2=CC=CC=C2
InChIKey ITLWSYAJGXPQSO-UHFFFAOYSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid is a white crystalline solid with a molecular weight of a...

Compound Q&A

How is 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2) typically synthesized?

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid is usually synthesized via a multistep process. It involv...

Compound Q&A

What precautions should be taken when handling 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

When handling 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid, it is essential to wear appropriate person...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...