Compound Q&A

How is 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2) typically synthesized?

Answer

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid
2-Methyl-[1,1'-biphenyl]-4-carboxylic acid is usually synthesized via a multistep process. It involves the coupling of 2-methylbiphenyl with benzoic anhydride followed by hydrolysis. The reaction typically occurs under mild conditions and uses appropriate catalysts to ensure high selectivity and yield. The final product is then purified to remove any byproducts and impurities.

About

English Name 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid
Molecular Formula C14H12O2
Molecular Weight 212.248 g/mol
SMILES CC1=C(C=CC(=C1)C(=O)O)C2=CC=CC=C2
InChIKey ITLWSYAJGXPQSO-UHFFFAOYSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid finds applications in various industries. It is used in t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

When handling 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid, it is essential to wear appropriate person...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...