Compound Q&A

What are the physical and chemical properties of 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

Answer

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid
2-Methyl-[1,1'-biphenyl]-4-carboxylic acid is a white crystalline solid with a molecular weight of approximately 254.28 g/mol. It has a melting point of 243-245°C and is slightly soluble in water. This compound is prone to hydrolysis under basic conditions and displays moderate acidity. It is less reactive than other carboxylic acids but can undergo esterification and other organic reactions.

About

English Name 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid
Molecular Formula C14H12O2
Molecular Weight 212.248 g/mol
SMILES CC1=C(C=CC(=C1)C(=O)O)C2=CC=CC=C2
InChIKey ITLWSYAJGXPQSO-UHFFFAOYSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

How is 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2) typically synthesized?

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid is usually synthesized via a multistep process. It involv...

Compound Q&A

What industries use 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

2-Methyl-[1,1'-biphenyl]-4-carboxylic acid finds applications in various industries. It is used in t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid (CAS: 178313-67-2)?

When handling 2-Methyl-[1,1'-biphenyl]-4-carboxylic acid, it is essential to wear appropriate person...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...